About 2-methylideneindol-1-ium
2-methylideneindol-1-ium (PubChem CID 59596733) has the molecular formula C9H8N+
and a molecular weight of 130.17 g/mol. Its IUPAC name is 2-methylideneindol-1-ium.
Molecular Properties
| Compound Name | 2-methylideneindol-1-ium |
| PubChem CID | 59596733 |
| Molecular Formula | C9H8N+ |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.07 |
| IUPAC Name | 2-methylideneindol-1-ium |
| SMILES | C=C1C=c2ccccc2=[NH+]1 |
| InChI | InChI=1S/C9H7N/c1-7-6-8-4-2-3-5-9(8)10-7/h2-6H,1H2/p+1 |
| InChIKey | DQNVJWKDCCSMLW-UHFFFAOYSA-O |
| XLogP | -1.31 |
| TPSA | 13.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methylideneindol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylideneindol-1-ium?
The IUPAC name of 2-methylideneindol-1-ium (CID 59596733) is 2-methylideneindol-1-ium.
What is the SMILES notation for 2-methylideneindol-1-ium?
The canonical SMILES for 2-methylideneindol-1-ium is C=C1C=c2ccccc2=[NH+]1.
What is the InChIKey of 2-methylideneindol-1-ium?
The InChIKey is DQNVJWKDCCSMLW-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H7N/c1-7-6-8-4-2-3-5-9(8)10-7/h2-6H,1H2/p+1.
What are the key properties of 2-methylideneindol-1-ium?
2-methylideneindol-1-ium has a molecular weight of 130.17 g/mol, XLogP of -1.31, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylideneindol-1-ium is sourced from PubChem (CID 59596733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).