About 6-methyl-4H-pyrimidin-4-id-2-amine;tris(yttrium)
6-methyl-4H-pyrimidin-4-id-2-amine;tris(yttrium) (PubChem CID 59597032) has the molecular formula C5H6N3Y3-
and a molecular weight of 374.84 g/mol. Its IUPAC name is 6-methyl-4H-pyrimidin-4-id-2-amine;tris(yttrium).
Molecular Properties
| Compound Name | 6-methyl-4H-pyrimidin-4-id-2-amine;tris(yttrium) |
| PubChem CID | 59597032 |
| Molecular Formula | C5H6N3Y3- |
| Molecular Weight | 374.84 g/mol |
| Exact Mass | 374.77 |
| IUPAC Name | 6-methyl-4H-pyrimidin-4-id-2-amine;tris(yttrium) |
| SMILES | Cc1c[c-]nc(N)n1.[Y].[Y].[Y] |
| InChI | InChI=1S/C5H6N3.3Y/c1-4-2-3-7-5(6)8-4;;;/h2H,1H3,(H2,6,7,8);;;/q-1;;; |
| InChIKey | PMWGUGJDAAEADX-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.84 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-4H-pyrimidin-4-id-2-amine;tris(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-4H-pyrimidin-4-id-2-amine;tris(yttrium)?
The IUPAC name of 6-methyl-4H-pyrimidin-4-id-2-amine;tris(yttrium) (CID 59597032) is 6-methyl-4H-pyrimidin-4-id-2-amine;tris(yttrium).
What is the SMILES notation for 6-methyl-4H-pyrimidin-4-id-2-amine;tris(yttrium)?
The canonical SMILES for 6-methyl-4H-pyrimidin-4-id-2-amine;tris(yttrium) is Cc1c[c-]nc(N)n1.[Y].[Y].[Y].
What is the InChIKey of 6-methyl-4H-pyrimidin-4-id-2-amine;tris(yttrium)?
The InChIKey is PMWGUGJDAAEADX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N3.3Y/c1-4-2-3-7-5(6)8-4;;;/h2H,1H3,(H2,6,7,8);;;/q-1;;;.
What are the key properties of 6-methyl-4H-pyrimidin-4-id-2-amine;tris(yttrium)?
6-methyl-4H-pyrimidin-4-id-2-amine;tris(yttrium) has a molecular weight of 374.84 g/mol, XLogP of 0.16, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-4H-pyrimidin-4-id-2-amine;tris(yttrium) is sourced from PubChem (CID 59597032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).