About deuteriomethane;(3S)-1-[(2R)-1-methanidyl-5-methylidenepyrrolidin-2-yl]pentan-3-ol;yttrium
deuteriomethane;(3S)-1-[(2R)-1-methanidyl-5-methylidenepyrrolidin-2-yl]pentan-3-ol;yttrium (PubChem CID 59597481) has the molecular formula C12H23NOY-2
and a molecular weight of 287.23 g/mol. Its IUPAC name is deuteriomethane;(3S)-1-[(2R)-1-methanidyl-5-methylidenepyrrolidin-2-yl]pentan-3-ol;yttrium.
Molecular Properties
| Compound Name | deuteriomethane;(3S)-1-[(2R)-1-methanidyl-5-methylidenepyrrolidin-2-yl]pentan-3-ol;yttrium |
| PubChem CID | 59597481 |
| Molecular Formula | C12H23NOY-2 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | deuteriomethane;(3S)-1-[(2R)-1-methanidyl-5-methylidenepyrrolidin-2-yl]pentan-3-ol;yttrium |
| SMILES | C=C1CC[C@H](CC[C@@H](O)CC)N1[CH2-].[2H][CH2-].[Y] |
| InChI | InChI=1S/C11H20NO.CH3.Y/c1-4-11(13)8-7-10-6-5-9(2)12(10)3;;/h10-11,13H,2-8H2,1H3;1H3;/q2*-1;/t10-,11+;;/m1../s1/i;1D; |
| InChIKey | CLNRGLKAZQPCKO-YRZSWVFPSA-N |
| XLogP | 2.75 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze deuteriomethane;(3S)-1-[(2R)-1-methanidyl-5-methylidenepyrrolidin-2-yl]pentan-3-ol;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuteriomethane;(3S)-1-[(2R)-1-methanidyl-5-methylidenepyrrolidin-2-yl]pentan-3-ol;yttrium?
The IUPAC name of deuteriomethane;(3S)-1-[(2R)-1-methanidyl-5-methylidenepyrrolidin-2-yl]pentan-3-ol;yttrium (CID 59597481) is deuteriomethane;(3S)-1-[(2R)-1-methanidyl-5-methylidenepyrrolidin-2-yl]pentan-3-ol;yttrium.
What is the SMILES notation for deuteriomethane;(3S)-1-[(2R)-1-methanidyl-5-methylidenepyrrolidin-2-yl]pentan-3-ol;yttrium?
The canonical SMILES for deuteriomethane;(3S)-1-[(2R)-1-methanidyl-5-methylidenepyrrolidin-2-yl]pentan-3-ol;yttrium is C=C1CC[C@H](CC[C@@H](O)CC)N1[CH2-].[2H][CH2-].[Y].
What is the InChIKey of deuteriomethane;(3S)-1-[(2R)-1-methanidyl-5-methylidenepyrrolidin-2-yl]pentan-3-ol;yttrium?
The InChIKey is CLNRGLKAZQPCKO-YRZSWVFPSA-N. The full InChI is InChI=1S/C11H20NO.CH3.Y/c1-4-11(13)8-7-10-6-5-9(2)12(10)3;;/h10-11,13H,2-8H2,1H3;1H3;/q2*-1;/t10-,11+;;/m1../s1/i;1D;.
What are the key properties of deuteriomethane;(3S)-1-[(2R)-1-methanidyl-5-methylidenepyrrolidin-2-yl]pentan-3-ol;yttrium?
deuteriomethane;(3S)-1-[(2R)-1-methanidyl-5-methylidenepyrrolidin-2-yl]pentan-3-ol;yttrium has a molecular weight of 287.23 g/mol, XLogP of 2.75, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for deuteriomethane;(3S)-1-[(2R)-1-methanidyl-5-methylidenepyrrolidin-2-yl]pentan-3-ol;yttrium is sourced from PubChem (CID 59597481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).