About ethyl 4-chloro-6-fluoro-1,5-naphthyridine-3-carboxylate
ethyl 4-chloro-6-fluoro-1,5-naphthyridine-3-carboxylate (PubChem CID 59597487) has the molecular formula C11H8ClFN2O2
and a molecular weight of 254.65 g/mol. Its IUPAC name is ethyl 4-chloro-6-fluoro-1,5-naphthyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-chloro-6-fluoro-1,5-naphthyridine-3-carboxylate |
| PubChem CID | 59597487 |
| Molecular Formula | C11H8ClFN2O2 |
| Molecular Weight | 254.65 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | ethyl 4-chloro-6-fluoro-1,5-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(F)nc2c1Cl |
| InChI | InChI=1S/C11H8ClFN2O2/c1-2-17-11(16)6-5-14-7-3-4-8(13)15-10(7)9(6)12/h3-5H,2H2,1H3 |
| InChIKey | DBGPGTXEGGUYSF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.65 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-chloro-6-fluoro-1,5-naphthyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-chloro-6-fluoro-1,5-naphthyridine-3-carboxylate?
The IUPAC name of ethyl 4-chloro-6-fluoro-1,5-naphthyridine-3-carboxylate (CID 59597487) is ethyl 4-chloro-6-fluoro-1,5-naphthyridine-3-carboxylate.
What is the SMILES notation for ethyl 4-chloro-6-fluoro-1,5-naphthyridine-3-carboxylate?
The canonical SMILES for ethyl 4-chloro-6-fluoro-1,5-naphthyridine-3-carboxylate is CCOC(=O)c1cnc2ccc(F)nc2c1Cl.
What is the InChIKey of ethyl 4-chloro-6-fluoro-1,5-naphthyridine-3-carboxylate?
The InChIKey is DBGPGTXEGGUYSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClFN2O2/c1-2-17-11(16)6-5-14-7-3-4-8(13)15-10(7)9(6)12/h3-5H,2H2,1H3.
What are the key properties of ethyl 4-chloro-6-fluoro-1,5-naphthyridine-3-carboxylate?
ethyl 4-chloro-6-fluoro-1,5-naphthyridine-3-carboxylate has a molecular weight of 254.65 g/mol, XLogP of 2.60, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-chloro-6-fluoro-1,5-naphthyridine-3-carboxylate is sourced from PubChem (CID 59597487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).