About 5-[(1,3-dimethyl-6-propan-2-ylindol-5-yl)methyl]pyrimidine-2,4-diamine
5-[(1,3-dimethyl-6-propan-2-ylindol-5-yl)methyl]pyrimidine-2,4-diamine (PubChem CID 59598651) has the molecular formula C18H23N5
and a molecular weight of 309.42 g/mol. Its IUPAC name is 5-[(1,3-dimethyl-6-propan-2-ylindol-5-yl)methyl]pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-[(1,3-dimethyl-6-propan-2-ylindol-5-yl)methyl]pyrimidine-2,4-diamine |
| PubChem CID | 59598651 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 5-[(1,3-dimethyl-6-propan-2-ylindol-5-yl)methyl]pyrimidine-2,4-diamine |
| SMILES | Cc1cn(C)c2cc(C(C)C)c(Cc3cnc(N)nc3N)cc12 |
| InChI | InChI=1S/C18H23N5/c1-10(2)14-7-16-15(11(3)9-23(16)4)6-12(14)5-13-8-21-18(20)22-17(13)19/h6-10H,5H2,1-4H3,(H4,19,20,21,22) |
| InChIKey | SWIWUCYUGGFXEO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(1,3-dimethyl-6-propan-2-ylindol-5-yl)methyl]pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1,3-dimethyl-6-propan-2-ylindol-5-yl)methyl]pyrimidine-2,4-diamine?
The IUPAC name of 5-[(1,3-dimethyl-6-propan-2-ylindol-5-yl)methyl]pyrimidine-2,4-diamine (CID 59598651) is 5-[(1,3-dimethyl-6-propan-2-ylindol-5-yl)methyl]pyrimidine-2,4-diamine.
What is the SMILES notation for 5-[(1,3-dimethyl-6-propan-2-ylindol-5-yl)methyl]pyrimidine-2,4-diamine?
The canonical SMILES for 5-[(1,3-dimethyl-6-propan-2-ylindol-5-yl)methyl]pyrimidine-2,4-diamine is Cc1cn(C)c2cc(C(C)C)c(Cc3cnc(N)nc3N)cc12.
What is the InChIKey of 5-[(1,3-dimethyl-6-propan-2-ylindol-5-yl)methyl]pyrimidine-2,4-diamine?
The InChIKey is SWIWUCYUGGFXEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N5/c1-10(2)14-7-16-15(11(3)9-23(16)4)6-12(14)5-13-8-21-18(20)22-17(13)19/h6-10H,5H2,1-4H3,(H4,19,20,21,22).
What are the key properties of 5-[(1,3-dimethyl-6-propan-2-ylindol-5-yl)methyl]pyrimidine-2,4-diamine?
5-[(1,3-dimethyl-6-propan-2-ylindol-5-yl)methyl]pyrimidine-2,4-diamine has a molecular weight of 309.42 g/mol, XLogP of 3.16, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1,3-dimethyl-6-propan-2-ylindol-5-yl)methyl]pyrimidine-2,4-diamine is sourced from PubChem (CID 59598651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).