About N-[5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-4-propan-2-ylphenyl]thiohydroxylamine
N-[5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-4-propan-2-ylphenyl]thiohydroxylamine (PubChem CID 59598712) has the molecular formula C14H19N5O2S
and a molecular weight of 321.41 g/mol. Its IUPAC name is N-[5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-4-propan-2-ylphenyl]thiohydroxylamine.
Molecular Properties
| Compound Name | N-[5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-4-propan-2-ylphenyl]thiohydroxylamine |
| PubChem CID | 59598712 |
| Molecular Formula | C14H19N5O2S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | N-[5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-4-propan-2-ylphenyl]thiohydroxylamine |
| SMILES | COc1cc(C(C)C)c(Oc2cnc(N)nc2N)cc1NS |
| InChI | InChI=1S/C14H19N5O2S/c1-7(2)8-4-11(20-3)9(19-22)5-10(8)21-12-6-17-14(16)18-13(12)15/h4-7,19,22H,1-3H3,(H4,15,16,17,18) |
| InChIKey | PUKPXSHOPPGTAU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-[5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-4-propan-2-ylphenyl]thiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-4-propan-2-ylphenyl]thiohydroxylamine?
The IUPAC name of N-[5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-4-propan-2-ylphenyl]thiohydroxylamine (CID 59598712) is N-[5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-4-propan-2-ylphenyl]thiohydroxylamine.
What is the SMILES notation for N-[5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-4-propan-2-ylphenyl]thiohydroxylamine?
The canonical SMILES for N-[5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-4-propan-2-ylphenyl]thiohydroxylamine is COc1cc(C(C)C)c(Oc2cnc(N)nc2N)cc1NS.
What is the InChIKey of N-[5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-4-propan-2-ylphenyl]thiohydroxylamine?
The InChIKey is PUKPXSHOPPGTAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N5O2S/c1-7(2)8-4-11(20-3)9(19-22)5-10(8)21-12-6-17-14(16)18-13(12)15/h4-7,19,22H,1-3H3,(H4,15,16,17,18).
What are the key properties of N-[5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-4-propan-2-ylphenyl]thiohydroxylamine?
N-[5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-4-propan-2-ylphenyl]thiohydroxylamine has a molecular weight of 321.41 g/mol, XLogP of 2.82, 5 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(2,4-diaminopyrimidin-5-yl)oxy-2-methoxy-4-propan-2-ylphenyl]thiohydroxylamine is sourced from PubChem (CID 59598712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).