About 3-methyl-N,N-di(propan-2-yl)-1,2,4-thiadiazol-5-amine
3-methyl-N,N-di(propan-2-yl)-1,2,4-thiadiazol-5-amine (PubChem CID 59598907) has the molecular formula C9H17N3S
and a molecular weight of 199.32 g/mol. Its IUPAC name is 3-methyl-N,N-di(propan-2-yl)-1,2,4-thiadiazol-5-amine.
Molecular Properties
| Compound Name | 3-methyl-N,N-di(propan-2-yl)-1,2,4-thiadiazol-5-amine |
| PubChem CID | 59598907 |
| Molecular Formula | C9H17N3S |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 3-methyl-N,N-di(propan-2-yl)-1,2,4-thiadiazol-5-amine |
| SMILES | Cc1nsc(N(C(C)C)C(C)C)n1 |
| InChI | InChI=1S/C9H17N3S/c1-6(2)12(7(3)4)9-10-8(5)11-13-9/h6-7H,1-5H3 |
| InChIKey | QIJHFXRWPPJXJH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-N,N-di(propan-2-yl)-1,2,4-thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N,N-di(propan-2-yl)-1,2,4-thiadiazol-5-amine?
The IUPAC name of 3-methyl-N,N-di(propan-2-yl)-1,2,4-thiadiazol-5-amine (CID 59598907) is 3-methyl-N,N-di(propan-2-yl)-1,2,4-thiadiazol-5-amine.
What is the SMILES notation for 3-methyl-N,N-di(propan-2-yl)-1,2,4-thiadiazol-5-amine?
The canonical SMILES for 3-methyl-N,N-di(propan-2-yl)-1,2,4-thiadiazol-5-amine is Cc1nsc(N(C(C)C)C(C)C)n1.
What is the InChIKey of 3-methyl-N,N-di(propan-2-yl)-1,2,4-thiadiazol-5-amine?
The InChIKey is QIJHFXRWPPJXJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3S/c1-6(2)12(7(3)4)9-10-8(5)11-13-9/h6-7H,1-5H3.
What are the key properties of 3-methyl-N,N-di(propan-2-yl)-1,2,4-thiadiazol-5-amine?
3-methyl-N,N-di(propan-2-yl)-1,2,4-thiadiazol-5-amine has a molecular weight of 199.32 g/mol, XLogP of 2.47, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N,N-di(propan-2-yl)-1,2,4-thiadiazol-5-amine is sourced from PubChem (CID 59598907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).