C27H31F2N3O — CID 59599009
(2R,3S)-4-(3,5-difluorophenyl)-1-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-(pyridin-3-ylamino)butan-2-ol (PubChem CID 59599009) has the molecular formula C27H31F2N3O and a molecular weight of 451.56 g/mol. Its IUPAC name is (2R,3S)-4-(3,5-difluorophenyl)-1-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-(pyridin-3-ylamino)butan-2-ol.
| Compound Name | (2R,3S)-4-(3,5-difluorophenyl)-1-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-(pyridin-3-ylamino)butan-2-ol |
|---|---|
| PubChem CID | 59599009 |
| Molecular Formula | C27H31F2N3O |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | (2R,3S)-4-(3,5-difluorophenyl)-1-[[(1S)-7-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-3-(pyridin-3-ylamino)butan-2-ol |
| SMILES | CCc1ccc2c(c1)[C@@H](NC[C@@H](O)[C@H](Cc1cc(F)cc(F)c1)Nc1cccnc1)CCC2 |
| InChI | InChI=1S/C27H31F2N3O/c1-2-18-8-9-20-5-3-7-25(24(20)13-18)31-17-27(33)26(32-23-6-4-10-30-16-23)14-19-11-21(28)15-22(29)12-19/h4,6,8-13,15-16,25-27,31-33H,2-3,5,7,14,17H2,1H3/t25-,26-,27+/m0/s1 |
| InChIKey | PGGZWRDKGJPBAA-GMQQYTKMSA-N |
| XLogP | 4.97 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |