About 6-(2-methylpropyl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine
6-(2-methylpropyl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 59599210) has the molecular formula C13H19NO2S
and a molecular weight of 253.37 g/mol. Its IUPAC name is 6-(2-methylpropyl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine.
Molecular Properties
| Compound Name | 6-(2-methylpropyl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine |
| PubChem CID | 59599210 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 6-(2-methylpropyl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | CC(C)Cc1ccc2c(c1)C(N)CCS2(=O)=O |
| InChI | InChI=1S/C13H19NO2S/c1-9(2)7-10-3-4-13-11(8-10)12(14)5-6-17(13,15)16/h3-4,8-9,12H,5-7,14H2,1-2H3 |
| InChIKey | GCKHZYOPYWOPKF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(2-methylpropyl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-methylpropyl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine?
The IUPAC name of 6-(2-methylpropyl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine (CID 59599210) is 6-(2-methylpropyl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine.
What is the SMILES notation for 6-(2-methylpropyl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine?
The canonical SMILES for 6-(2-methylpropyl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine is CC(C)Cc1ccc2c(c1)C(N)CCS2(=O)=O.
What is the InChIKey of 6-(2-methylpropyl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine?
The InChIKey is GCKHZYOPYWOPKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2S/c1-9(2)7-10-3-4-13-11(8-10)12(14)5-6-17(13,15)16/h3-4,8-9,12H,5-7,14H2,1-2H3.
What are the key properties of 6-(2-methylpropyl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine?
6-(2-methylpropyl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine has a molecular weight of 253.37 g/mol, XLogP of 2.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-methylpropyl)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine is sourced from PubChem (CID 59599210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).