C9H16N2 — CID 59599961
1,3,4,5,6-pentamethylpyrimidin-1-ium-6-ide (PubChem CID 59599961) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 1,3,4,5,6-pentamethylpyrimidin-1-ium-6-ide.
| Compound Name | 1,3,4,5,6-pentamethylpyrimidin-1-ium-6-ide |
|---|---|
| PubChem CID | 59599961 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 1,3,4,5,6-pentamethylpyrimidin-1-ium-6-ide |
| SMILES | CC1=C(C)N(C)C=[N+](C)[C-]1C |
| InChI | InChI=1S/C9H16N2/c1-7-8(2)10(4)6-11(5)9(7)3/h6H,1-5H3 |
| InChIKey | KNHLOLQETAJMEZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|