C26H28N6O2 — CID 59600332
2-[4-[4-methyl-6-(4-naphthalen-1-yloxyanilino)-1,3,5-triazin-2-yl]piperazin-1-yl]ethanol (PubChem CID 59600332) has the molecular formula C26H28N6O2 and a molecular weight of 456.55 g/mol. Its IUPAC name is 2-[4-[4-methyl-6-(4-naphthalen-1-yloxyanilino)-1,3,5-triazin-2-yl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[4-methyl-6-(4-naphthalen-1-yloxyanilino)-1,3,5-triazin-2-yl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 59600332 |
| Molecular Formula | C26H28N6O2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 2-[4-[4-methyl-6-(4-naphthalen-1-yloxyanilino)-1,3,5-triazin-2-yl]piperazin-1-yl]ethanol |
| SMILES | Cc1nc(Nc2ccc(Oc3cccc4ccccc34)cc2)nc(N2CCN(CCO)CC2)n1 |
| InChI | InChI=1S/C26H28N6O2/c1-19-27-25(30-26(28-19)32-15-13-31(14-16-32)17-18-33)29-21-9-11-22(12-10-21)34-24-8-4-6-20-5-2-3-7-23(20)24/h2-12,33H,13-18H2,1H3,(H,27,28,29,30) |
| InChIKey | XZCFRLZUAMQHDN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_B(4)', 'substructure': 'N/A'} |
|---|