C27H32IN7O3 — CID 59600348
[4-[4-[[4-[4-(2-hydroxyethyl)piperazin-1-yl]-6-methyl-1,3,5-triazin-2-yl]amino]phenoxy]phenyl]-[(2S)-1-iodopyrrolidin-2-yl]methanone (PubChem CID 59600348) has the molecular formula C27H32IN7O3 and a molecular weight of 629.50 g/mol. Its IUPAC name is [4-[4-[[4-[4-(2-hydroxyethyl)piperazin-1-yl]-6-methyl-1,3,5-triazin-2-yl]amino]phenoxy]phenyl]-[(2S)-1-iodopyrrolidin-2-yl]methanone.
| Compound Name | [4-[4-[[4-[4-(2-hydroxyethyl)piperazin-1-yl]-6-methyl-1,3,5-triazin-2-yl]amino]phenoxy]phenyl]-[(2S)-1-iodopyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 59600348 |
| Molecular Formula | C27H32IN7O3 |
| Molecular Weight | 629.50 g/mol |
| Exact Mass | 629.16 |
| IUPAC Name | [4-[4-[[4-[4-(2-hydroxyethyl)piperazin-1-yl]-6-methyl-1,3,5-triazin-2-yl]amino]phenoxy]phenyl]-[(2S)-1-iodopyrrolidin-2-yl]methanone |
| SMILES | Cc1nc(Nc2ccc(Oc3ccc(C(=O)[C@@H]4CCCN4I)cc3)cc2)nc(N2CCN(CCO)CC2)n1 |
| InChI | InChI=1S/C27H32IN7O3/c1-19-29-26(32-27(30-19)34-15-13-33(14-16-34)17-18-36)31-21-6-10-23(11-7-21)38-22-8-4-20(5-9-22)25(37)24-3-2-12-35(24)28/h4-11,24,36H,2-3,12-18H2,1H3,(H,29,30,31,32)/t24-/m0/s1 |
| InChIKey | YQXPHEYZNUHBPH-DEOSSOPVSA-N |
| XLogP | 3.83 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|