About [1,3]oxazolo[5,4-d][1,3]oxazole
[1,3]oxazolo[5,4-d][1,3]oxazole (PubChem CID 59600546) has the molecular formula C4H2N2O2
and a molecular weight of 110.07 g/mol. Its IUPAC name is [1,3]oxazolo[5,4-d][1,3]oxazole.
Molecular Properties
| Compound Name | [1,3]oxazolo[5,4-d][1,3]oxazole |
| PubChem CID | 59600546 |
| Molecular Formula | C4H2N2O2 |
| Molecular Weight | 110.07 g/mol |
| Exact Mass | 110.01 |
| IUPAC Name | [1,3]oxazolo[5,4-d][1,3]oxazole |
| SMILES | c1nc2ocnc2o1 |
| InChI | InChI=1S/C4H2N2O2/c1-5-3-4(7-1)6-2-8-3/h1-2H |
| InChIKey | CFZWJJYKHSHYLL-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.07 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1,3]oxazolo[5,4-d][1,3]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3]oxazolo[5,4-d][1,3]oxazole?
The IUPAC name of [1,3]oxazolo[5,4-d][1,3]oxazole (CID 59600546) is [1,3]oxazolo[5,4-d][1,3]oxazole.
What is the SMILES notation for [1,3]oxazolo[5,4-d][1,3]oxazole?
The canonical SMILES for [1,3]oxazolo[5,4-d][1,3]oxazole is c1nc2ocnc2o1.
What is the InChIKey of [1,3]oxazolo[5,4-d][1,3]oxazole?
The InChIKey is CFZWJJYKHSHYLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2N2O2/c1-5-3-4(7-1)6-2-8-3/h1-2H.
What are the key properties of [1,3]oxazolo[5,4-d][1,3]oxazole?
[1,3]oxazolo[5,4-d][1,3]oxazole has a molecular weight of 110.07 g/mol, XLogP of 0.82, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3]oxazolo[5,4-d][1,3]oxazole is sourced from PubChem (CID 59600546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).