C15H19N4O2+ — CID 59600688
4-ethyl-N-(4-methoxy-5,6-dimethyl-1,3,5-triazin-5-ium-2-yl)benzamide (PubChem CID 59600688) has the molecular formula C15H19N4O2+ and a molecular weight of 287.34 g/mol. Its IUPAC name is 4-ethyl-N-(4-methoxy-5,6-dimethyl-1,3,5-triazin-5-ium-2-yl)benzamide.
| Compound Name | 4-ethyl-N-(4-methoxy-5,6-dimethyl-1,3,5-triazin-5-ium-2-yl)benzamide |
|---|---|
| PubChem CID | 59600688 |
| Molecular Formula | C15H19N4O2+ |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 4-ethyl-N-(4-methoxy-5,6-dimethyl-1,3,5-triazin-5-ium-2-yl)benzamide |
| SMILES | CCc1ccc(C(=O)Nc2nc(C)[n+](C)c(OC)n2)cc1 |
| InChI | InChI=1S/C15H18N4O2/c1-5-11-6-8-12(9-7-11)13(20)17-14-16-10(2)19(3)15(18-14)21-4/h6-9H,5H2,1-4H3/p+1 |
| InChIKey | QVCYDNBCNKXJSO-UHFFFAOYSA-O |
| XLogP | 1.43 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|