About CID 59601164
CID 59601164 (PubChem CID 59601164) has the molecular formula C29H18F6O10S3
and a molecular weight of 736.64 g/mol.
Molecular Properties
| Compound Name | CID 59601164 |
| PubChem CID | 59601164 |
| Molecular Formula | C29H18F6O10S3 |
| Molecular Weight | 736.64 g/mol |
| Exact Mass | 736.00 |
| IUPAC Name | — |
| SMILES | O=C1c2c(-c3cc4c(s3)C3(OCCO3)C(F)(F)C43OCCO3)sc(-c3cc4c(s3)C3(OCCO3)C(F)(F)C43OCCO3)c2C(=O)C1(F)F |
| InChI | InChI=1S/C29H18F6O10S3/c30-23(31)19(36)15-16(20(23)37)18(14-10-12-22(47-14)27(44-7-8-45-27)29(34,35)25(12)40-3-4-41-25)48-17(15)13-9-11-21(46-13)26(42-5-6-43-26)28(32,33)24(11)38-1-2-39-24/h9-10H,1-8H2 |
| InChIKey | GDOYRIGLSARXQX-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 736.64 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze CID 59601164 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59601164?
The IUPAC name of CID 59601164 (CID 59601164) is not available.
What is the SMILES notation for CID 59601164?
The canonical SMILES for CID 59601164 is O=C1c2c(-c3cc4c(s3)C3(OCCO3)C(F)(F)C43OCCO3)sc(-c3cc4c(s3)C3(OCCO3)C(F)(F)C43OCCO3)c2C(=O)C1(F)F.
What is the InChIKey of CID 59601164?
The InChIKey is GDOYRIGLSARXQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H18F6O10S3/c30-23(31)19(36)15-16(20(23)37)18(14-10-12-22(47-14)27(44-7-8-45-27)29(34,35)25(12)40-3-4-41-25)48-17(15)13-9-11-21(46-13)26(42-5-6-43-26)28(32,33)24(11)38-1-2-39-24/h9-10H,1-8H2.
What are the key properties of CID 59601164?
CID 59601164 has a molecular weight of 736.64 g/mol, XLogP of 5.32, 2 rotatable bonds, 0 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59601164 is sourced from PubChem (CID 59601164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).