C12H15Li2N7O5S2 — CID 59601313
dilithium;3-[[4-amino-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]benzene-4-ide-1-sulfonate (PubChem CID 59601313) has the molecular formula C12H15Li2N7O5S2 and a molecular weight of 415.31 g/mol. Its IUPAC name is dilithium;3-[[4-amino-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]benzene-4-ide-1-sulfonate.
| Compound Name | dilithium;3-[[4-amino-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]benzene-4-ide-1-sulfonate |
|---|---|
| PubChem CID | 59601313 |
| Molecular Formula | C12H15Li2N7O5S2 |
| Molecular Weight | 415.31 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | dilithium;3-[[4-amino-6-[2-(methanesulfonamido)ethylamino]-1,3,5-triazin-2-yl]amino]benzene-4-ide-1-sulfonate |
| SMILES | CS(=O)(=O)NCCNc1nc(N)nc(Nc2[c-]ccc(S(=O)(=O)[O-])c2)n1.[Li+].[Li+] |
| InChI | InChI=1S/C12H16N7O5S2.2Li/c1-25(20,21)15-6-5-14-11-17-10(13)18-12(19-11)16-8-3-2-4-9(7-8)26(22,23)24;;/h2,4,7,15H,5-6H2,1H3,(H,22,23,24)(H4,13,14,16,17,18,19);;/q-1;2*+1/p-1 |
| InChIKey | HYGUVWXAKUHEHK-UHFFFAOYSA-M |
| XLogP | -7.13 |
| TPSA | 192.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.31 |
| LogP ≤ 5 | -7.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|