C22H30N4O8 — CID 59601455
(3S)-3-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]-2-phenylacetyl]amino]-3-methylbutanoyl]amino]-4-oxopentanoic acid (PubChem CID 59601455) has the molecular formula C22H30N4O8 and a molecular weight of 478.50 g/mol. Its IUPAC name is (3S)-3-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]-2-phenylacetyl]amino]-3-methylbutanoyl]amino]-4-oxopentanoic acid.
| Compound Name | (3S)-3-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]-2-phenylacetyl]amino]-3-methylbutanoyl]amino]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 59601455 |
| Molecular Formula | C22H30N4O8 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | (3S)-3-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-carboxypropanoyl]amino]-2-phenylacetyl]amino]-3-methylbutanoyl]amino]-4-oxopentanoic acid |
| SMILES | CC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](N)CC(=O)O)c1ccccc1)C(C)C |
| InChI | InChI=1S/C22H30N4O8/c1-11(2)18(21(33)24-15(12(3)27)10-17(30)31)25-22(34)19(13-7-5-4-6-8-13)26-20(32)14(23)9-16(28)29/h4-8,11,14-15,18-19H,9-10,23H2,1-3H3,(H,24,33)(H,25,34)(H,26,32)(H,28,29)(H,30,31)/t14-,15-,18-,19-/m0/s1 |
| InChIKey | JPZPBSIUSRICKJ-LNMJFAINSA-N |
| XLogP | -0.66 |
| TPSA | 204.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |