C42H39F3O7 — CID 59601902
[6-[4-(7-prop-2-enoyloxyheptoxy)benzoyl]oxy-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 4-[4-(trifluoromethyl)phenyl]benzoate (PubChem CID 59601902) has the molecular formula C42H39F3O7 and a molecular weight of 712.76 g/mol. Its IUPAC name is [6-[4-(7-prop-2-enoyloxyheptoxy)benzoyl]oxy-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 4-[4-(trifluoromethyl)phenyl]benzoate.
| Compound Name | [6-[4-(7-prop-2-enoyloxyheptoxy)benzoyl]oxy-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 4-[4-(trifluoromethyl)phenyl]benzoate |
|---|---|
| PubChem CID | 59601902 |
| Molecular Formula | C42H39F3O7 |
| Molecular Weight | 712.76 g/mol |
| Exact Mass | 712.26 |
| IUPAC Name | [6-[4-(7-prop-2-enoyloxyheptoxy)benzoyl]oxy-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 4-[4-(trifluoromethyl)phenyl]benzoate |
| SMILES | C=CC(=O)OCCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(-c4ccc(C(F)(F)F)cc4)cc3)c3c2C2CCC3C2)cc1 |
| InChI | InChI=1S/C42H39F3O7/c1-2-37(46)50-25-7-5-3-4-6-24-49-34-20-16-30(17-21-34)41(48)52-36-23-22-35(38-31-12-13-32(26-31)39(36)38)51-40(47)29-10-8-27(9-11-29)28-14-18-33(19-15-28)42(43,44)45/h2,8-11,14-23,31-32H,1,3-7,12-13,24-26H2 |
| InChIKey | CEQJWOVITWNINX-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.76 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|