C38H43NO8 — CID 59601932
[6-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 5-pentoxypyridine-2-carboxylate (PubChem CID 59601932) has the molecular formula C38H43NO8 and a molecular weight of 641.76 g/mol. Its IUPAC name is [6-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 5-pentoxypyridine-2-carboxylate.
| Compound Name | [6-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 5-pentoxypyridine-2-carboxylate |
|---|---|
| PubChem CID | 59601932 |
| Molecular Formula | C38H43NO8 |
| Molecular Weight | 641.76 g/mol |
| Exact Mass | 641.30 |
| IUPAC Name | [6-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 5-pentoxypyridine-2-carboxylate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCCC)cn3)c3c2C2CCC3C2)cc1 |
| InChI | InChI=1S/C38H43NO8/c1-3-5-8-21-44-30-17-18-31(39-25-30)38(42)47-33-20-19-32(35-27-11-12-28(24-27)36(33)35)46-37(41)26-13-15-29(16-14-26)43-22-9-6-7-10-23-45-34(40)4-2/h4,13-20,25,27-28H,2-3,5-12,21-24H2,1H3 |
| InChIKey | GPGPCOWMWRKFSV-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 110.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.76 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|