About 1-(2-methoxyethyl)-2,3-dimethylimidazol-3-ium
1-(2-methoxyethyl)-2,3-dimethylimidazol-3-ium (PubChem CID 59602015) has the molecular formula C8H15N2O+
and a molecular weight of 155.22 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-2,3-dimethylimidazol-3-ium.
Molecular Properties
| Compound Name | 1-(2-methoxyethyl)-2,3-dimethylimidazol-3-ium |
| PubChem CID | 59602015 |
| Molecular Formula | C8H15N2O+ |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.12 |
| IUPAC Name | 1-(2-methoxyethyl)-2,3-dimethylimidazol-3-ium |
| SMILES | COCCn1cc[n+](C)c1C |
| InChI | InChI=1S/C8H15N2O/c1-8-9(2)4-5-10(8)6-7-11-3/h4-5H,6-7H2,1-3H3/q+1 |
| InChIKey | VXAOTIPQBWKOOS-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methoxyethyl)-2,3-dimethylimidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxyethyl)-2,3-dimethylimidazol-3-ium?
The IUPAC name of 1-(2-methoxyethyl)-2,3-dimethylimidazol-3-ium (CID 59602015) is 1-(2-methoxyethyl)-2,3-dimethylimidazol-3-ium.
What is the SMILES notation for 1-(2-methoxyethyl)-2,3-dimethylimidazol-3-ium?
The canonical SMILES for 1-(2-methoxyethyl)-2,3-dimethylimidazol-3-ium is COCCn1cc[n+](C)c1C.
What is the InChIKey of 1-(2-methoxyethyl)-2,3-dimethylimidazol-3-ium?
The InChIKey is VXAOTIPQBWKOOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N2O/c1-8-9(2)4-5-10(8)6-7-11-3/h4-5H,6-7H2,1-3H3/q+1.
What are the key properties of 1-(2-methoxyethyl)-2,3-dimethylimidazol-3-ium?
1-(2-methoxyethyl)-2,3-dimethylimidazol-3-ium has a molecular weight of 155.22 g/mol, XLogP of 0.27, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxyethyl)-2,3-dimethylimidazol-3-ium is sourced from PubChem (CID 59602015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).