About 5-[(2,2-difluoro-2-oxidoperoxysulfanylethoxy)methyl]adamantan-2-ol
5-[(2,2-difluoro-2-oxidoperoxysulfanylethoxy)methyl]adamantan-2-ol (PubChem CID 59602078) has the molecular formula C13H19F2O5S-
and a molecular weight of 325.35 g/mol. Its IUPAC name is 5-[(2,2-difluoro-2-oxidoperoxysulfanylethoxy)methyl]adamantan-2-ol.
Molecular Properties
| Compound Name | 5-[(2,2-difluoro-2-oxidoperoxysulfanylethoxy)methyl]adamantan-2-ol |
| PubChem CID | 59602078 |
| Molecular Formula | C13H19F2O5S- |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 5-[(2,2-difluoro-2-oxidoperoxysulfanylethoxy)methyl]adamantan-2-ol |
| SMILES | [O-]OOSC(F)(F)COCC12CC3CC(C1)C(O)C(C3)C2 |
| InChI | InChI=1S/C13H20F2O5S/c14-13(15,21-20-19-17)7-18-6-12-3-8-1-9(4-12)11(16)10(2-8)5-12/h8-11,16-17H,1-7H2/p-1 |
| InChIKey | UUMPQWMVEYNSOC-UHFFFAOYSA-M |
| XLogP | 1.65 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2,2-difluoro-2-oxidoperoxysulfanylethoxy)methyl]adamantan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,2-difluoro-2-oxidoperoxysulfanylethoxy)methyl]adamantan-2-ol?
The IUPAC name of 5-[(2,2-difluoro-2-oxidoperoxysulfanylethoxy)methyl]adamantan-2-ol (CID 59602078) is 5-[(2,2-difluoro-2-oxidoperoxysulfanylethoxy)methyl]adamantan-2-ol.
What is the SMILES notation for 5-[(2,2-difluoro-2-oxidoperoxysulfanylethoxy)methyl]adamantan-2-ol?
The canonical SMILES for 5-[(2,2-difluoro-2-oxidoperoxysulfanylethoxy)methyl]adamantan-2-ol is [O-]OOSC(F)(F)COCC12CC3CC(C1)C(O)C(C3)C2.
What is the InChIKey of 5-[(2,2-difluoro-2-oxidoperoxysulfanylethoxy)methyl]adamantan-2-ol?
The InChIKey is UUMPQWMVEYNSOC-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H20F2O5S/c14-13(15,21-20-19-17)7-18-6-12-3-8-1-9(4-12)11(16)10(2-8)5-12/h8-11,16-17H,1-7H2/p-1.
What are the key properties of 5-[(2,2-difluoro-2-oxidoperoxysulfanylethoxy)methyl]adamantan-2-ol?
5-[(2,2-difluoro-2-oxidoperoxysulfanylethoxy)methyl]adamantan-2-ol has a molecular weight of 325.35 g/mol, XLogP of 1.65, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,2-difluoro-2-oxidoperoxysulfanylethoxy)methyl]adamantan-2-ol is sourced from PubChem (CID 59602078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).