About [4-[2-(3,5-dimethyl-1-adamantyl)-2-oxoethoxy]phenyl]-diphenylsulfanium
[4-[2-(3,5-dimethyl-1-adamantyl)-2-oxoethoxy]phenyl]-diphenylsulfanium (PubChem CID 59602115) has the molecular formula C32H35O2S+
and a molecular weight of 483.70 g/mol. Its IUPAC name is [4-[2-(3,5-dimethyl-1-adamantyl)-2-oxoethoxy]phenyl]-diphenylsulfanium.
Molecular Properties
| Compound Name | [4-[2-(3,5-dimethyl-1-adamantyl)-2-oxoethoxy]phenyl]-diphenylsulfanium |
| PubChem CID | 59602115 |
| Molecular Formula | C32H35O2S+ |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | [4-[2-(3,5-dimethyl-1-adamantyl)-2-oxoethoxy]phenyl]-diphenylsulfanium |
| SMILES | CC12CC3CC(C)(C1)CC(C(=O)COc1ccc([S+](c4ccccc4)c4ccccc4)cc1)(C3)C2 |
| InChI | InChI=1S/C32H35O2S/c1-30-17-24-18-31(2,21-30)23-32(19-24,22-30)29(33)20-34-25-13-15-28(16-14-25)35(26-9-5-3-6-10-26)27-11-7-4-8-12-27/h3-16,24H,17-23H2,1-2H3/q+1 |
| InChIKey | YBDPDSAYKVCYQH-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(3,5-dimethyl-1-adamantyl)-2-oxoethoxy]phenyl]-diphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(3,5-dimethyl-1-adamantyl)-2-oxoethoxy]phenyl]-diphenylsulfanium?
The IUPAC name of [4-[2-(3,5-dimethyl-1-adamantyl)-2-oxoethoxy]phenyl]-diphenylsulfanium (CID 59602115) is [4-[2-(3,5-dimethyl-1-adamantyl)-2-oxoethoxy]phenyl]-diphenylsulfanium.
What is the SMILES notation for [4-[2-(3,5-dimethyl-1-adamantyl)-2-oxoethoxy]phenyl]-diphenylsulfanium?
The canonical SMILES for [4-[2-(3,5-dimethyl-1-adamantyl)-2-oxoethoxy]phenyl]-diphenylsulfanium is CC12CC3CC(C)(C1)CC(C(=O)COc1ccc([S+](c4ccccc4)c4ccccc4)cc1)(C3)C2.
What is the InChIKey of [4-[2-(3,5-dimethyl-1-adamantyl)-2-oxoethoxy]phenyl]-diphenylsulfanium?
The InChIKey is YBDPDSAYKVCYQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H35O2S/c1-30-17-24-18-31(2,21-30)23-32(19-24,22-30)29(33)20-34-25-13-15-28(16-14-25)35(26-9-5-3-6-10-26)27-11-7-4-8-12-27/h3-16,24H,17-23H2,1-2H3/q+1.
What are the key properties of [4-[2-(3,5-dimethyl-1-adamantyl)-2-oxoethoxy]phenyl]-diphenylsulfanium?
[4-[2-(3,5-dimethyl-1-adamantyl)-2-oxoethoxy]phenyl]-diphenylsulfanium has a molecular weight of 483.70 g/mol, XLogP of 7.73, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(3,5-dimethyl-1-adamantyl)-2-oxoethoxy]phenyl]-diphenylsulfanium is sourced from PubChem (CID 59602115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).