About (4,4-dimethyl-2-oxooxolan-3-yl) 2,2-difluoropropanoate
(4,4-dimethyl-2-oxooxolan-3-yl) 2,2-difluoropropanoate (PubChem CID 59602294) has the molecular formula C9H12F2O4
and a molecular weight of 222.19 g/mol. Its IUPAC name is (4,4-dimethyl-2-oxooxolan-3-yl) 2,2-difluoropropanoate.
Analyze (4,4-dimethyl-2-oxooxolan-3-yl) 2,2-difluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-dimethyl-2-oxooxolan-3-yl) 2,2-difluoropropanoate?
The IUPAC name of (4,4-dimethyl-2-oxooxolan-3-yl) 2,2-difluoropropanoate (CID 59602294) is (4,4-dimethyl-2-oxooxolan-3-yl) 2,2-difluoropropanoate.
What is the SMILES notation for (4,4-dimethyl-2-oxooxolan-3-yl) 2,2-difluoropropanoate?
The canonical SMILES for (4,4-dimethyl-2-oxooxolan-3-yl) 2,2-difluoropropanoate is CC(F)(F)C(=O)OC1C(=O)OCC1(C)C.
What is the InChIKey of (4,4-dimethyl-2-oxooxolan-3-yl) 2,2-difluoropropanoate?
The InChIKey is JCRPBKLHCIAULF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2O4/c1-8(2)4-14-6(12)5(8)15-7(13)9(3,10)11/h5H,4H2,1-3H3.
What are the key properties of (4,4-dimethyl-2-oxooxolan-3-yl) 2,2-difluoropropanoate?
(4,4-dimethyl-2-oxooxolan-3-yl) 2,2-difluoropropanoate has a molecular weight of 222.19 g/mol, XLogP of 1.14, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-dimethyl-2-oxooxolan-3-yl) 2,2-difluoropropanoate is sourced from PubChem (CID 59602294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).