About [3-(2,4-dimethylphenyl)-1-adamantyl]methyl 2,2-difluoropropanoate
[3-(2,4-dimethylphenyl)-1-adamantyl]methyl 2,2-difluoropropanoate (PubChem CID 59602299) has the molecular formula C22H28F2O2
and a molecular weight of 362.46 g/mol. Its IUPAC name is [3-(2,4-dimethylphenyl)-1-adamantyl]methyl 2,2-difluoropropanoate.
Molecular Properties
| Compound Name | [3-(2,4-dimethylphenyl)-1-adamantyl]methyl 2,2-difluoropropanoate |
| PubChem CID | 59602299 |
| Molecular Formula | C22H28F2O2 |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | [3-(2,4-dimethylphenyl)-1-adamantyl]methyl 2,2-difluoropropanoate |
| SMILES | Cc1ccc(C23CC4CC(CC(COC(=O)C(C)(F)F)(C4)C2)C3)c(C)c1 |
| InChI | InChI=1S/C22H28F2O2/c1-14-4-5-18(15(2)6-14)22-10-16-7-17(11-22)9-21(8-16,12-22)13-26-19(25)20(3,23)24/h4-6,16-17H,7-13H2,1-3H3 |
| InChIKey | RLNJYJTXWNFIBB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3-(2,4-dimethylphenyl)-1-adamantyl]methyl 2,2-difluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2,4-dimethylphenyl)-1-adamantyl]methyl 2,2-difluoropropanoate?
The IUPAC name of [3-(2,4-dimethylphenyl)-1-adamantyl]methyl 2,2-difluoropropanoate (CID 59602299) is [3-(2,4-dimethylphenyl)-1-adamantyl]methyl 2,2-difluoropropanoate.
What is the SMILES notation for [3-(2,4-dimethylphenyl)-1-adamantyl]methyl 2,2-difluoropropanoate?
The canonical SMILES for [3-(2,4-dimethylphenyl)-1-adamantyl]methyl 2,2-difluoropropanoate is Cc1ccc(C23CC4CC(CC(COC(=O)C(C)(F)F)(C4)C2)C3)c(C)c1.
What is the InChIKey of [3-(2,4-dimethylphenyl)-1-adamantyl]methyl 2,2-difluoropropanoate?
The InChIKey is RLNJYJTXWNFIBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28F2O2/c1-14-4-5-18(15(2)6-14)22-10-16-7-17(11-22)9-21(8-16,12-22)13-26-19(25)20(3,23)24/h4-6,16-17H,7-13H2,1-3H3.
What are the key properties of [3-(2,4-dimethylphenyl)-1-adamantyl]methyl 2,2-difluoropropanoate?
[3-(2,4-dimethylphenyl)-1-adamantyl]methyl 2,2-difluoropropanoate has a molecular weight of 362.46 g/mol, XLogP of 5.34, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2,4-dimethylphenyl)-1-adamantyl]methyl 2,2-difluoropropanoate is sourced from PubChem (CID 59602299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).