About 8-tricyclo[5.2.1.02,6]decanyl 2,2-difluoropropanoate
8-tricyclo[5.2.1.02,6]decanyl 2,2-difluoropropanoate (PubChem CID 59602353) has the molecular formula C13H18F2O2
and a molecular weight of 244.28 g/mol. Its IUPAC name is 8-tricyclo[5.2.1.02,6]decanyl 2,2-difluoropropanoate.
Molecular Properties
| Compound Name | 8-tricyclo[5.2.1.02,6]decanyl 2,2-difluoropropanoate |
| PubChem CID | 59602353 |
| Molecular Formula | C13H18F2O2 |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 8-tricyclo[5.2.1.02,6]decanyl 2,2-difluoropropanoate |
| SMILES | CC(F)(F)C(=O)OC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C13H18F2O2/c1-13(14,15)12(16)17-11-6-7-5-10(11)9-4-2-3-8(7)9/h7-11H,2-6H2,1H3 |
| InChIKey | RZXHGLPBTFJJPC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-tricyclo[5.2.1.02,6]decanyl 2,2-difluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-tricyclo[5.2.1.02,6]decanyl 2,2-difluoropropanoate?
The IUPAC name of 8-tricyclo[5.2.1.02,6]decanyl 2,2-difluoropropanoate (CID 59602353) is 8-tricyclo[5.2.1.02,6]decanyl 2,2-difluoropropanoate.
What is the SMILES notation for 8-tricyclo[5.2.1.02,6]decanyl 2,2-difluoropropanoate?
The canonical SMILES for 8-tricyclo[5.2.1.02,6]decanyl 2,2-difluoropropanoate is CC(F)(F)C(=O)OC1CC2CC1C1CCCC21.
What is the InChIKey of 8-tricyclo[5.2.1.02,6]decanyl 2,2-difluoropropanoate?
The InChIKey is RZXHGLPBTFJJPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F2O2/c1-13(14,15)12(16)17-11-6-7-5-10(11)9-4-2-3-8(7)9/h7-11H,2-6H2,1H3.
What are the key properties of 8-tricyclo[5.2.1.02,6]decanyl 2,2-difluoropropanoate?
8-tricyclo[5.2.1.02,6]decanyl 2,2-difluoropropanoate has a molecular weight of 244.28 g/mol, XLogP of 3.01, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-tricyclo[5.2.1.02,6]decanyl 2,2-difluoropropanoate is sourced from PubChem (CID 59602353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).