About 8-(2-methylprop-1-enoxy)tricyclo[5.2.1.02,6]decane
8-(2-methylprop-1-enoxy)tricyclo[5.2.1.02,6]decane (PubChem CID 59602559) has the molecular formula C14H22O
and a molecular weight of 206.33 g/mol. Its IUPAC name is 8-(2-methylprop-1-enoxy)tricyclo[5.2.1.02,6]decane.
Molecular Properties
| Compound Name | 8-(2-methylprop-1-enoxy)tricyclo[5.2.1.02,6]decane |
| PubChem CID | 59602559 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 8-(2-methylprop-1-enoxy)tricyclo[5.2.1.02,6]decane |
| SMILES | CC(C)=COC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C14H22O/c1-9(2)8-15-14-7-10-6-13(14)12-5-3-4-11(10)12/h8,10-14H,3-7H2,1-2H3 |
| InChIKey | PTHJQYPJNIRLOU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 8-(2-methylprop-1-enoxy)tricyclo[5.2.1.02,6]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2-methylprop-1-enoxy)tricyclo[5.2.1.02,6]decane?
The IUPAC name of 8-(2-methylprop-1-enoxy)tricyclo[5.2.1.02,6]decane (CID 59602559) is 8-(2-methylprop-1-enoxy)tricyclo[5.2.1.02,6]decane.
What is the SMILES notation for 8-(2-methylprop-1-enoxy)tricyclo[5.2.1.02,6]decane?
The canonical SMILES for 8-(2-methylprop-1-enoxy)tricyclo[5.2.1.02,6]decane is CC(C)=COC1CC2CC1C1CCCC21.
What is the InChIKey of 8-(2-methylprop-1-enoxy)tricyclo[5.2.1.02,6]decane?
The InChIKey is PTHJQYPJNIRLOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O/c1-9(2)8-15-14-7-10-6-13(14)12-5-3-4-11(10)12/h8,10-14H,3-7H2,1-2H3.
What are the key properties of 8-(2-methylprop-1-enoxy)tricyclo[5.2.1.02,6]decane?
8-(2-methylprop-1-enoxy)tricyclo[5.2.1.02,6]decane has a molecular weight of 206.33 g/mol, XLogP of 3.75, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2-methylprop-1-enoxy)tricyclo[5.2.1.02,6]decane is sourced from PubChem (CID 59602559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).