C17H32N2O2 — CID 59602715
1,3-bis(4,4-dimethylpentyl)imidazolidine-2,4-dione (PubChem CID 59602715) has the molecular formula C17H32N2O2 and a molecular weight of 296.45 g/mol. Its IUPAC name is 1,3-bis(4,4-dimethylpentyl)imidazolidine-2,4-dione.
| Compound Name | 1,3-bis(4,4-dimethylpentyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59602715 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 1,3-bis(4,4-dimethylpentyl)imidazolidine-2,4-dione |
| SMILES | CC(C)(C)CCCN1CC(=O)N(CCCC(C)(C)C)C1=O |
| InChI | InChI=1S/C17H32N2O2/c1-16(2,3)9-7-11-18-13-14(20)19(15(18)21)12-8-10-17(4,5)6/h7-13H2,1-6H3 |
| InChIKey | SITXQDGXMDBHKJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|