C20H32N2O3 — CID 59602730
1,3-bis(4,4-dimethylhex-5-enyl)-1,3-diazinane-2,4,6-trione (PubChem CID 59602730) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is 1,3-bis(4,4-dimethylhex-5-enyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-bis(4,4-dimethylhex-5-enyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 59602730 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | 1,3-bis(4,4-dimethylhex-5-enyl)-1,3-diazinane-2,4,6-trione |
| SMILES | C=CC(C)(C)CCCN1C(=O)CC(=O)N(CCCC(C)(C)C=C)C1=O |
| InChI | InChI=1S/C20H32N2O3/c1-7-19(3,4)11-9-13-21-16(23)15-17(24)22(18(21)25)14-10-12-20(5,6)8-2/h7-8H,1-2,9-15H2,3-6H3 |
| InChIKey | CPVHUDSGDUBBAN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|