About 3,3-dimethyl-1-(2-methyl-1,3-dithian-2-yl)butan-2-amine
3,3-dimethyl-1-(2-methyl-1,3-dithian-2-yl)butan-2-amine (PubChem CID 59602983) has the molecular formula C11H23NS2
and a molecular weight of 233.45 g/mol. Its IUPAC name is 3,3-dimethyl-1-(2-methyl-1,3-dithian-2-yl)butan-2-amine.
Molecular Properties
| Compound Name | 3,3-dimethyl-1-(2-methyl-1,3-dithian-2-yl)butan-2-amine |
| PubChem CID | 59602983 |
| Molecular Formula | C11H23NS2 |
| Molecular Weight | 233.45 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 3,3-dimethyl-1-(2-methyl-1,3-dithian-2-yl)butan-2-amine |
| SMILES | CC1(CC(N)C(C)(C)C)SCCCS1 |
| InChI | InChI=1S/C11H23NS2/c1-10(2,3)9(12)8-11(4)13-6-5-7-14-11/h9H,5-8,12H2,1-4H3 |
| InChIKey | ZJTGHVGYXPEOIS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,3-dimethyl-1-(2-methyl-1,3-dithian-2-yl)butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-1-(2-methyl-1,3-dithian-2-yl)butan-2-amine?
The IUPAC name of 3,3-dimethyl-1-(2-methyl-1,3-dithian-2-yl)butan-2-amine (CID 59602983) is 3,3-dimethyl-1-(2-methyl-1,3-dithian-2-yl)butan-2-amine.
What is the SMILES notation for 3,3-dimethyl-1-(2-methyl-1,3-dithian-2-yl)butan-2-amine?
The canonical SMILES for 3,3-dimethyl-1-(2-methyl-1,3-dithian-2-yl)butan-2-amine is CC1(CC(N)C(C)(C)C)SCCCS1.
What is the InChIKey of 3,3-dimethyl-1-(2-methyl-1,3-dithian-2-yl)butan-2-amine?
The InChIKey is ZJTGHVGYXPEOIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NS2/c1-10(2,3)9(12)8-11(4)13-6-5-7-14-11/h9H,5-8,12H2,1-4H3.
What are the key properties of 3,3-dimethyl-1-(2-methyl-1,3-dithian-2-yl)butan-2-amine?
3,3-dimethyl-1-(2-methyl-1,3-dithian-2-yl)butan-2-amine has a molecular weight of 233.45 g/mol, XLogP of 3.34, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-1-(2-methyl-1,3-dithian-2-yl)butan-2-amine is sourced from PubChem (CID 59602983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).