C15H15ClNO6P — CID 59603063
4-[[(2R,4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]-N,N-dihydroxyaniline (PubChem CID 59603063) has the molecular formula C15H15ClNO6P and a molecular weight of 371.71 g/mol. Its IUPAC name is 4-[[(2R,4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]-N,N-dihydroxyaniline.
| Compound Name | 4-[[(2R,4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]-N,N-dihydroxyaniline |
|---|---|
| PubChem CID | 59603063 |
| Molecular Formula | C15H15ClNO6P |
| Molecular Weight | 371.71 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 4-[[(2R,4S)-4-(3-chlorophenyl)-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]oxy]-N,N-dihydroxyaniline |
| SMILES | O=[P@@]1(Oc2ccc(N(O)O)cc2)OCC[C@@H](c2cccc(Cl)c2)O1 |
| InChI | InChI=1S/C15H15ClNO6P/c16-12-3-1-2-11(10-12)15-8-9-21-24(20,23-15)22-14-6-4-13(5-7-14)17(18)19/h1-7,10,15,18-19H,8-9H2/t15-,24-/m0/s1 |
| InChIKey | MQGXQSGVZLQBGJ-OWJWWREXSA-N |
| XLogP | 4.59 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.71 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|