About (2R,3S)-2-(2,4-difluorophenyl)-3-(3-fluoro-2-pyridinyl)-1-(tetrazol-1-yl)butan-2-ol
(2R,3S)-2-(2,4-difluorophenyl)-3-(3-fluoro-2-pyridinyl)-1-(tetrazol-1-yl)butan-2-ol (PubChem CID 59603345) has the molecular formula C16H14F3N5O
and a molecular weight of 349.32 g/mol. Its IUPAC name is (2R,3S)-2-(2,4-difluorophenyl)-3-(3-fluoro-2-pyridinyl)-1-(tetrazol-1-yl)butan-2-ol.
Molecular Properties
| Compound Name | (2R,3S)-2-(2,4-difluorophenyl)-3-(3-fluoro-2-pyridinyl)-1-(tetrazol-1-yl)butan-2-ol |
| PubChem CID | 59603345 |
| Molecular Formula | C16H14F3N5O |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (2R,3S)-2-(2,4-difluorophenyl)-3-(3-fluoro-2-pyridinyl)-1-(tetrazol-1-yl)butan-2-ol |
| SMILES | C[C@@H](c1ncccc1F)[C@](O)(Cn1cnnn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H14F3N5O/c1-10(15-13(18)3-2-6-20-15)16(25,8-24-9-21-22-23-24)12-5-4-11(17)7-14(12)19/h2-7,9-10,25H,8H2,1H3/t10-,16+/m0/s1 |
| InChIKey | PDNMIUUIQQWTJV-MGPLVRAMSA-N |
| XLogP | 2.18 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2R,3S)-2-(2,4-difluorophenyl)-3-(3-fluoro-2-pyridinyl)-1-(tetrazol-1-yl)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-2-(2,4-difluorophenyl)-3-(3-fluoro-2-pyridinyl)-1-(tetrazol-1-yl)butan-2-ol?
The IUPAC name of (2R,3S)-2-(2,4-difluorophenyl)-3-(3-fluoro-2-pyridinyl)-1-(tetrazol-1-yl)butan-2-ol (CID 59603345) is (2R,3S)-2-(2,4-difluorophenyl)-3-(3-fluoro-2-pyridinyl)-1-(tetrazol-1-yl)butan-2-ol.
What is the SMILES notation for (2R,3S)-2-(2,4-difluorophenyl)-3-(3-fluoro-2-pyridinyl)-1-(tetrazol-1-yl)butan-2-ol?
The canonical SMILES for (2R,3S)-2-(2,4-difluorophenyl)-3-(3-fluoro-2-pyridinyl)-1-(tetrazol-1-yl)butan-2-ol is C[C@@H](c1ncccc1F)[C@](O)(Cn1cnnn1)c1ccc(F)cc1F.
What is the InChIKey of (2R,3S)-2-(2,4-difluorophenyl)-3-(3-fluoro-2-pyridinyl)-1-(tetrazol-1-yl)butan-2-ol?
The InChIKey is PDNMIUUIQQWTJV-MGPLVRAMSA-N. The full InChI is InChI=1S/C16H14F3N5O/c1-10(15-13(18)3-2-6-20-15)16(25,8-24-9-21-22-23-24)12-5-4-11(17)7-14(12)19/h2-7,9-10,25H,8H2,1H3/t10-,16+/m0/s1.
What are the key properties of (2R,3S)-2-(2,4-difluorophenyl)-3-(3-fluoro-2-pyridinyl)-1-(tetrazol-1-yl)butan-2-ol?
(2R,3S)-2-(2,4-difluorophenyl)-3-(3-fluoro-2-pyridinyl)-1-(tetrazol-1-yl)butan-2-ol has a molecular weight of 349.32 g/mol, XLogP of 2.18, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-2-(2,4-difluorophenyl)-3-(3-fluoro-2-pyridinyl)-1-(tetrazol-1-yl)butan-2-ol is sourced from PubChem (CID 59603345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).