About (E)-1-(2,4-dimethylphenyl)-N-[(2,4-dimethylphenyl)methoxy]butan-1-imine
(E)-1-(2,4-dimethylphenyl)-N-[(2,4-dimethylphenyl)methoxy]butan-1-imine (PubChem CID 59603400) has the molecular formula C21H27NO
and a molecular weight of 309.45 g/mol. Its IUPAC name is (E)-1-(2,4-dimethylphenyl)-N-[(2,4-dimethylphenyl)methoxy]butan-1-imine.
Molecular Properties
| Compound Name | (E)-1-(2,4-dimethylphenyl)-N-[(2,4-dimethylphenyl)methoxy]butan-1-imine |
| PubChem CID | 59603400 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (E)-1-(2,4-dimethylphenyl)-N-[(2,4-dimethylphenyl)methoxy]butan-1-imine |
| SMILES | CCC/C(=N\OCc1ccc(C)cc1C)c1ccc(C)cc1C |
| InChI | InChI=1S/C21H27NO/c1-6-7-21(20-11-9-16(3)13-18(20)5)22-23-14-19-10-8-15(2)12-17(19)4/h8-13H,6-7,14H2,1-5H3/b22-21+ |
| InChIKey | UEVZGACUUXMHQQ-QURGRASLSA-N |
| XLogP | 5.64 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(2,4-dimethylphenyl)-N-[(2,4-dimethylphenyl)methoxy]butan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(2,4-dimethylphenyl)-N-[(2,4-dimethylphenyl)methoxy]butan-1-imine?
The IUPAC name of (E)-1-(2,4-dimethylphenyl)-N-[(2,4-dimethylphenyl)methoxy]butan-1-imine (CID 59603400) is (E)-1-(2,4-dimethylphenyl)-N-[(2,4-dimethylphenyl)methoxy]butan-1-imine.
What is the SMILES notation for (E)-1-(2,4-dimethylphenyl)-N-[(2,4-dimethylphenyl)methoxy]butan-1-imine?
The canonical SMILES for (E)-1-(2,4-dimethylphenyl)-N-[(2,4-dimethylphenyl)methoxy]butan-1-imine is CCC/C(=N\OCc1ccc(C)cc1C)c1ccc(C)cc1C.
What is the InChIKey of (E)-1-(2,4-dimethylphenyl)-N-[(2,4-dimethylphenyl)methoxy]butan-1-imine?
The InChIKey is UEVZGACUUXMHQQ-QURGRASLSA-N. The full InChI is InChI=1S/C21H27NO/c1-6-7-21(20-11-9-16(3)13-18(20)5)22-23-14-19-10-8-15(2)12-17(19)4/h8-13H,6-7,14H2,1-5H3/b22-21+.
What are the key properties of (E)-1-(2,4-dimethylphenyl)-N-[(2,4-dimethylphenyl)methoxy]butan-1-imine?
(E)-1-(2,4-dimethylphenyl)-N-[(2,4-dimethylphenyl)methoxy]butan-1-imine has a molecular weight of 309.45 g/mol, XLogP of 5.64, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(2,4-dimethylphenyl)-N-[(2,4-dimethylphenyl)methoxy]butan-1-imine is sourced from PubChem (CID 59603400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).