About 3,3-difluoro-N,N-dimethyl-1-(2-methylpropyl)piperidin-4-amine
3,3-difluoro-N,N-dimethyl-1-(2-methylpropyl)piperidin-4-amine (PubChem CID 59603412) has the molecular formula C11H22F2N2
and a molecular weight of 220.31 g/mol. Its IUPAC name is 3,3-difluoro-N,N-dimethyl-1-(2-methylpropyl)piperidin-4-amine.
Molecular Properties
| Compound Name | 3,3-difluoro-N,N-dimethyl-1-(2-methylpropyl)piperidin-4-amine |
| PubChem CID | 59603412 |
| Molecular Formula | C11H22F2N2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 3,3-difluoro-N,N-dimethyl-1-(2-methylpropyl)piperidin-4-amine |
| SMILES | CC(C)CN1CCC(N(C)C)C(F)(F)C1 |
| InChI | InChI=1S/C11H22F2N2/c1-9(2)7-15-6-5-10(14(3)4)11(12,13)8-15/h9-10H,5-8H2,1-4H3 |
| InChIKey | BETACLCWIXEHAP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-difluoro-N,N-dimethyl-1-(2-methylpropyl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-N,N-dimethyl-1-(2-methylpropyl)piperidin-4-amine?
The IUPAC name of 3,3-difluoro-N,N-dimethyl-1-(2-methylpropyl)piperidin-4-amine (CID 59603412) is 3,3-difluoro-N,N-dimethyl-1-(2-methylpropyl)piperidin-4-amine.
What is the SMILES notation for 3,3-difluoro-N,N-dimethyl-1-(2-methylpropyl)piperidin-4-amine?
The canonical SMILES for 3,3-difluoro-N,N-dimethyl-1-(2-methylpropyl)piperidin-4-amine is CC(C)CN1CCC(N(C)C)C(F)(F)C1.
What is the InChIKey of 3,3-difluoro-N,N-dimethyl-1-(2-methylpropyl)piperidin-4-amine?
The InChIKey is BETACLCWIXEHAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22F2N2/c1-9(2)7-15-6-5-10(14(3)4)11(12,13)8-15/h9-10H,5-8H2,1-4H3.
What are the key properties of 3,3-difluoro-N,N-dimethyl-1-(2-methylpropyl)piperidin-4-amine?
3,3-difluoro-N,N-dimethyl-1-(2-methylpropyl)piperidin-4-amine has a molecular weight of 220.31 g/mol, XLogP of 1.91, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-N,N-dimethyl-1-(2-methylpropyl)piperidin-4-amine is sourced from PubChem (CID 59603412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).