About cis-(1S,2R)-3,3-difluoro-2-(propan-2-ylamino)cyclohexan-1-ol
cis-(1S,2R)-3,3-difluoro-2-(propan-2-ylamino)cyclohexan-1-ol (PubChem CID 59603982) has the molecular formula C9H17F2NO
and a molecular weight of 193.24 g/mol. Its IUPAC name is cis-(1S,2R)-3,3-difluoro-2-(propan-2-ylamino)cyclohexan-1-ol.
Molecular Properties
| Compound Name | cis-(1S,2R)-3,3-difluoro-2-(propan-2-ylamino)cyclohexan-1-ol |
| PubChem CID | 59603982 |
| Molecular Formula | C9H17F2NO |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | cis-(1S,2R)-3,3-difluoro-2-(propan-2-ylamino)cyclohexan-1-ol |
| SMILES | CC(C)N[C@@H]1[C@@H](O)CCCC1(F)F |
| InChI | InChI=1S/C9H17F2NO/c1-6(2)12-8-7(13)4-3-5-9(8,10)11/h6-8,12-13H,3-5H2,1-2H3/t7-,8+/m0/s1 |
| InChIKey | KWRNUQYCWYRCFQ-JGVFFNPUSA-N |
| XLogP | 1.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cis-(1S,2R)-3,3-difluoro-2-(propan-2-ylamino)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-3,3-difluoro-2-(propan-2-ylamino)cyclohexan-1-ol?
The IUPAC name of cis-(1S,2R)-3,3-difluoro-2-(propan-2-ylamino)cyclohexan-1-ol (CID 59603982) is cis-(1S,2R)-3,3-difluoro-2-(propan-2-ylamino)cyclohexan-1-ol.
What is the SMILES notation for cis-(1S,2R)-3,3-difluoro-2-(propan-2-ylamino)cyclohexan-1-ol?
The canonical SMILES for cis-(1S,2R)-3,3-difluoro-2-(propan-2-ylamino)cyclohexan-1-ol is CC(C)N[C@@H]1[C@@H](O)CCCC1(F)F.
What is the InChIKey of cis-(1S,2R)-3,3-difluoro-2-(propan-2-ylamino)cyclohexan-1-ol?
The InChIKey is KWRNUQYCWYRCFQ-JGVFFNPUSA-N. The full InChI is InChI=1S/C9H17F2NO/c1-6(2)12-8-7(13)4-3-5-9(8,10)11/h6-8,12-13H,3-5H2,1-2H3/t7-,8+/m0/s1.
What are the key properties of cis-(1S,2R)-3,3-difluoro-2-(propan-2-ylamino)cyclohexan-1-ol?
cis-(1S,2R)-3,3-difluoro-2-(propan-2-ylamino)cyclohexan-1-ol has a molecular weight of 193.24 g/mol, XLogP of 1.53, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-3,3-difluoro-2-(propan-2-ylamino)cyclohexan-1-ol is sourced from PubChem (CID 59603982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).