C6H10Cl2F2N2 — CID 59603992
cis-(1S,2R)-1-N,2-N-dichloro-3,3-difluorocyclohexane-1,2-diamine (PubChem CID 59603992) has the molecular formula C6H10Cl2F2N2 and a molecular weight of 219.06 g/mol. Its IUPAC name is cis-(1S,2R)-1-N,2-N-dichloro-3,3-difluorocyclohexane-1,2-diamine.
| Compound Name | cis-(1S,2R)-1-N,2-N-dichloro-3,3-difluorocyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 59603992 |
| Molecular Formula | C6H10Cl2F2N2 |
| Molecular Weight | 219.06 g/mol |
| Exact Mass | 218.02 |
| IUPAC Name | cis-(1S,2R)-1-N,2-N-dichloro-3,3-difluorocyclohexane-1,2-diamine |
| SMILES | FC1(F)CCC[C@H](NCl)[C@H]1NCl |
| InChI | InChI=1S/C6H10Cl2F2N2/c7-11-4-2-1-3-6(9,10)5(4)12-8/h4-5,11-12H,1-3H2/t4-,5+/m0/s1 |
| InChIKey | KDRPJBOCSFYPPI-CRCLSJGQSA-N |
| XLogP | 2.03 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.06 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|