About 2-bromo-5-fluoro-N'-hydroxybenzenecarboximidamide
2-bromo-5-fluoro-N'-hydroxybenzenecarboximidamide (PubChem CID 59604223) has the molecular formula C7H6BrFN2O
and a molecular weight of 233.04 g/mol. Its IUPAC name is 2-bromo-5-fluoro-N'-hydroxybenzenecarboximidamide.
Molecular Properties
| Compound Name | 2-bromo-5-fluoro-N'-hydroxybenzenecarboximidamide |
| PubChem CID | 59604223 |
| Molecular Formula | C7H6BrFN2O |
| Molecular Weight | 233.04 g/mol |
| Exact Mass | 231.96 |
| IUPAC Name | 2-bromo-5-fluoro-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N\O)c1cc(F)ccc1Br |
| InChI | InChI=1S/C7H6BrFN2O/c8-6-2-1-4(9)3-5(6)7(10)11-12/h1-3,12H,(H2,10,11) |
| InChIKey | UNPLRUDHIXPQPC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.04 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-5-fluoro-N'-hydroxybenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-fluoro-N'-hydroxybenzenecarboximidamide?
The IUPAC name of 2-bromo-5-fluoro-N'-hydroxybenzenecarboximidamide (CID 59604223) is 2-bromo-5-fluoro-N'-hydroxybenzenecarboximidamide.
What is the SMILES notation for 2-bromo-5-fluoro-N'-hydroxybenzenecarboximidamide?
The canonical SMILES for 2-bromo-5-fluoro-N'-hydroxybenzenecarboximidamide is N/C(=N\O)c1cc(F)ccc1Br.
What is the InChIKey of 2-bromo-5-fluoro-N'-hydroxybenzenecarboximidamide?
The InChIKey is UNPLRUDHIXPQPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrFN2O/c8-6-2-1-4(9)3-5(6)7(10)11-12/h1-3,12H,(H2,10,11).
What are the key properties of 2-bromo-5-fluoro-N'-hydroxybenzenecarboximidamide?
2-bromo-5-fluoro-N'-hydroxybenzenecarboximidamide has a molecular weight of 233.04 g/mol, XLogP of 1.68, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-fluoro-N'-hydroxybenzenecarboximidamide is sourced from PubChem (CID 59604223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).