About 1-(azetidin-3-yl)-4,4-difluoropiperidine
1-(azetidin-3-yl)-4,4-difluoropiperidine (PubChem CID 59605315) has the molecular formula C8H14F2N2
and a molecular weight of 176.21 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-4,4-difluoropiperidine.
Molecular Properties
| Compound Name | 1-(azetidin-3-yl)-4,4-difluoropiperidine |
| PubChem CID | 59605315 |
| Molecular Formula | C8H14F2N2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 1-(azetidin-3-yl)-4,4-difluoropiperidine |
| SMILES | FC1(F)CCN(C2CNC2)CC1 |
| InChI | InChI=1S/C8H14F2N2/c9-8(10)1-3-12(4-2-8)7-5-11-6-7/h7,11H,1-6H2 |
| InChIKey | OIQJXEUDXZJIRR-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(azetidin-3-yl)-4,4-difluoropiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azetidin-3-yl)-4,4-difluoropiperidine?
The IUPAC name of 1-(azetidin-3-yl)-4,4-difluoropiperidine (CID 59605315) is 1-(azetidin-3-yl)-4,4-difluoropiperidine.
What is the SMILES notation for 1-(azetidin-3-yl)-4,4-difluoropiperidine?
The canonical SMILES for 1-(azetidin-3-yl)-4,4-difluoropiperidine is FC1(F)CCN(C2CNC2)CC1.
What is the InChIKey of 1-(azetidin-3-yl)-4,4-difluoropiperidine?
The InChIKey is OIQJXEUDXZJIRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2N2/c9-8(10)1-3-12(4-2-8)7-5-11-6-7/h7,11H,1-6H2.
What are the key properties of 1-(azetidin-3-yl)-4,4-difluoropiperidine?
1-(azetidin-3-yl)-4,4-difluoropiperidine has a molecular weight of 176.21 g/mol, XLogP of 0.69, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azetidin-3-yl)-4,4-difluoropiperidine is sourced from PubChem (CID 59605315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).