C22H25FN8O — CID 59605531
4-[2-(2-ethylbenzimidazol-1-yl)-8-(3-fluoroazetidin-3-yl)-9-methylpurin-6-yl]morpholine (PubChem CID 59605531) has the molecular formula C22H25FN8O and a molecular weight of 436.50 g/mol. Its IUPAC name is 4-[2-(2-ethylbenzimidazol-1-yl)-8-(3-fluoroazetidin-3-yl)-9-methylpurin-6-yl]morpholine.
| Compound Name | 4-[2-(2-ethylbenzimidazol-1-yl)-8-(3-fluoroazetidin-3-yl)-9-methylpurin-6-yl]morpholine |
|---|---|
| PubChem CID | 59605531 |
| Molecular Formula | C22H25FN8O |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 4-[2-(2-ethylbenzimidazol-1-yl)-8-(3-fluoroazetidin-3-yl)-9-methylpurin-6-yl]morpholine |
| SMILES | CCc1nc2ccccc2n1-c1nc(N2CCOCC2)c2nc(C3(F)CNC3)n(C)c2n1 |
| InChI | InChI=1S/C22H25FN8O/c1-3-16-25-14-6-4-5-7-15(14)31(16)21-27-18-17(19(28-21)30-8-10-32-11-9-30)26-20(29(18)2)22(23)12-24-13-22/h4-7,24H,3,8-13H2,1-2H3 |
| InChIKey | XIIKIYITRRFUMP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 85.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |