C24H30N8O — CID 59605636
4-[9-methyl-2-(2-methylbenzimidazol-1-yl)-8-(piperidin-4-ylmethyl)purin-6-yl]morpholine (PubChem CID 59605636) has the molecular formula C24H30N8O and a molecular weight of 446.56 g/mol. Its IUPAC name is 4-[9-methyl-2-(2-methylbenzimidazol-1-yl)-8-(piperidin-4-ylmethyl)purin-6-yl]morpholine.
| Compound Name | 4-[9-methyl-2-(2-methylbenzimidazol-1-yl)-8-(piperidin-4-ylmethyl)purin-6-yl]morpholine |
|---|---|
| PubChem CID | 59605636 |
| Molecular Formula | C24H30N8O |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 4-[9-methyl-2-(2-methylbenzimidazol-1-yl)-8-(piperidin-4-ylmethyl)purin-6-yl]morpholine |
| SMILES | Cc1nc2ccccc2n1-c1nc(N2CCOCC2)c2nc(CC3CCNCC3)n(C)c2n1 |
| InChI | InChI=1S/C24H30N8O/c1-16-26-18-5-3-4-6-19(18)32(16)24-28-22-21(23(29-24)31-11-13-33-14-12-31)27-20(30(22)2)15-17-7-9-25-10-8-17/h3-6,17,25H,7-15H2,1-2H3 |
| InChIKey | HKQMNWYATCGDGI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 85.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |