About 2-methyl-5,6,7,8-tetrahydrochromen-4-one
2-methyl-5,6,7,8-tetrahydrochromen-4-one (PubChem CID 596062) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is 2-methyl-5,6,7,8-tetrahydrochromen-4-one.
Molecular Properties
| Compound Name | 2-methyl-5,6,7,8-tetrahydrochromen-4-one |
| PubChem CID | 596062 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 2-methyl-5,6,7,8-tetrahydrochromen-4-one |
| SMILES | Cc1cc(=O)c2c(o1)CCCC2 |
| InChI | InChI=1S/C10H12O2/c1-7-6-9(11)8-4-2-3-5-10(8)12-7/h6H,2-5H2,1H3 |
| InChIKey | YZYTUKCUCAZYHF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-5,6,7,8-tetrahydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5,6,7,8-tetrahydrochromen-4-one?
The IUPAC name of 2-methyl-5,6,7,8-tetrahydrochromen-4-one (CID 596062) is 2-methyl-5,6,7,8-tetrahydrochromen-4-one.
What is the SMILES notation for 2-methyl-5,6,7,8-tetrahydrochromen-4-one?
The canonical SMILES for 2-methyl-5,6,7,8-tetrahydrochromen-4-one is Cc1cc(=O)c2c(o1)CCCC2.
What is the InChIKey of 2-methyl-5,6,7,8-tetrahydrochromen-4-one?
The InChIKey is YZYTUKCUCAZYHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-7-6-9(11)8-4-2-3-5-10(8)12-7/h6H,2-5H2,1H3.
What are the key properties of 2-methyl-5,6,7,8-tetrahydrochromen-4-one?
2-methyl-5,6,7,8-tetrahydrochromen-4-one has a molecular weight of 164.20 g/mol, XLogP of 1.83, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5,6,7,8-tetrahydrochromen-4-one is sourced from PubChem (CID 596062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).