About 5-chloro-6-iodo-3,4-dihydro-2H-chromene
5-chloro-6-iodo-3,4-dihydro-2H-chromene (PubChem CID 59606716) has the molecular formula C9H8ClIO
and a molecular weight of 294.52 g/mol. Its IUPAC name is 5-chloro-6-iodo-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | 5-chloro-6-iodo-3,4-dihydro-2H-chromene |
| PubChem CID | 59606716 |
| Molecular Formula | C9H8ClIO |
| Molecular Weight | 294.52 g/mol |
| Exact Mass | 293.93 |
| IUPAC Name | 5-chloro-6-iodo-3,4-dihydro-2H-chromene |
| SMILES | Clc1c(I)ccc2c1CCCO2 |
| InChI | InChI=1S/C9H8ClIO/c10-9-6-2-1-5-12-8(6)4-3-7(9)11/h3-4H,1-2,5H2 |
| InChIKey | DABGDJXVQYMLHY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-6-iodo-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-6-iodo-3,4-dihydro-2H-chromene?
The IUPAC name of 5-chloro-6-iodo-3,4-dihydro-2H-chromene (CID 59606716) is 5-chloro-6-iodo-3,4-dihydro-2H-chromene.
What is the SMILES notation for 5-chloro-6-iodo-3,4-dihydro-2H-chromene?
The canonical SMILES for 5-chloro-6-iodo-3,4-dihydro-2H-chromene is Clc1c(I)ccc2c1CCCO2.
What is the InChIKey of 5-chloro-6-iodo-3,4-dihydro-2H-chromene?
The InChIKey is DABGDJXVQYMLHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClIO/c10-9-6-2-1-5-12-8(6)4-3-7(9)11/h3-4H,1-2,5H2.
What are the key properties of 5-chloro-6-iodo-3,4-dihydro-2H-chromene?
5-chloro-6-iodo-3,4-dihydro-2H-chromene has a molecular weight of 294.52 g/mol, XLogP of 3.27, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-6-iodo-3,4-dihydro-2H-chromene is sourced from PubChem (CID 59606716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).