C16H11F7N2O — CID 59607199
4-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methyl-N-pyridin-3-ylbenzamide (PubChem CID 59607199) has the molecular formula C16H11F7N2O and a molecular weight of 380.26 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methyl-N-pyridin-3-ylbenzamide.
| Compound Name | 4-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methyl-N-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 59607199 |
| Molecular Formula | C16H11F7N2O |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 4-(1,1,2,2,3,3,3-heptafluoropropyl)-N-methyl-N-pyridin-3-ylbenzamide |
| SMILES | CN(C(=O)c1ccc(C(F)(F)C(F)(F)C(F)(F)F)cc1)c1cccnc1 |
| InChI | InChI=1S/C16H11F7N2O/c1-25(12-3-2-8-24-9-12)13(26)10-4-6-11(7-5-10)14(17,18)15(19,20)16(21,22)23/h2-9H,1H3 |
| InChIKey | OKMGAACIWWDONK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|