About 1-[3-[[4-[5-(2,5-dichlorophenyl)thiophen-2-yl]pyrimidin-2-yl]amino]phenyl]ethanol
1-[3-[[4-[5-(2,5-dichlorophenyl)thiophen-2-yl]pyrimidin-2-yl]amino]phenyl]ethanol (PubChem CID 59607448) has the molecular formula C22H17Cl2N3OS
and a molecular weight of 442.37 g/mol. Its IUPAC name is 1-[3-[[4-[5-(2,5-dichlorophenyl)thiophen-2-yl]pyrimidin-2-yl]amino]phenyl]ethanol.
Molecular Properties
| Compound Name | 1-[3-[[4-[5-(2,5-dichlorophenyl)thiophen-2-yl]pyrimidin-2-yl]amino]phenyl]ethanol |
| PubChem CID | 59607448 |
| Molecular Formula | C22H17Cl2N3OS |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | 1-[3-[[4-[5-(2,5-dichlorophenyl)thiophen-2-yl]pyrimidin-2-yl]amino]phenyl]ethanol |
| SMILES | CC(O)c1cccc(Nc2nccc(-c3ccc(-c4cc(Cl)ccc4Cl)s3)n2)c1 |
| InChI | InChI=1S/C22H17Cl2N3OS/c1-13(28)14-3-2-4-16(11-14)26-22-25-10-9-19(27-22)21-8-7-20(29-21)17-12-15(23)5-6-18(17)24/h2-13,28H,1H3,(H,25,26,27) |
| InChIKey | GBCMYKWTXTZRRO-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[3-[[4-[5-(2,5-dichlorophenyl)thiophen-2-yl]pyrimidin-2-yl]amino]phenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[[4-[5-(2,5-dichlorophenyl)thiophen-2-yl]pyrimidin-2-yl]amino]phenyl]ethanol?
The IUPAC name of 1-[3-[[4-[5-(2,5-dichlorophenyl)thiophen-2-yl]pyrimidin-2-yl]amino]phenyl]ethanol (CID 59607448) is 1-[3-[[4-[5-(2,5-dichlorophenyl)thiophen-2-yl]pyrimidin-2-yl]amino]phenyl]ethanol.
What is the SMILES notation for 1-[3-[[4-[5-(2,5-dichlorophenyl)thiophen-2-yl]pyrimidin-2-yl]amino]phenyl]ethanol?
The canonical SMILES for 1-[3-[[4-[5-(2,5-dichlorophenyl)thiophen-2-yl]pyrimidin-2-yl]amino]phenyl]ethanol is CC(O)c1cccc(Nc2nccc(-c3ccc(-c4cc(Cl)ccc4Cl)s3)n2)c1.
What is the InChIKey of 1-[3-[[4-[5-(2,5-dichlorophenyl)thiophen-2-yl]pyrimidin-2-yl]amino]phenyl]ethanol?
The InChIKey is GBCMYKWTXTZRRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17Cl2N3OS/c1-13(28)14-3-2-4-16(11-14)26-22-25-10-9-19(27-22)21-8-7-20(29-21)17-12-15(23)5-6-18(17)24/h2-13,28H,1H3,(H,25,26,27).
What are the key properties of 1-[3-[[4-[5-(2,5-dichlorophenyl)thiophen-2-yl]pyrimidin-2-yl]amino]phenyl]ethanol?
1-[3-[[4-[5-(2,5-dichlorophenyl)thiophen-2-yl]pyrimidin-2-yl]amino]phenyl]ethanol has a molecular weight of 442.37 g/mol, XLogP of 6.98, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[[4-[5-(2,5-dichlorophenyl)thiophen-2-yl]pyrimidin-2-yl]amino]phenyl]ethanol is sourced from PubChem (CID 59607448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).