C26H26N2O2S — CID 59607533
1-[3-[[4-[5-(2-propan-2-yloxyphenyl)thiophen-2-yl]pyrimidin-2-yl]methyl]phenyl]ethanol (PubChem CID 59607533) has the molecular formula C26H26N2O2S and a molecular weight of 430.57 g/mol. Its IUPAC name is 1-[3-[[4-[5-(2-propan-2-yloxyphenyl)thiophen-2-yl]pyrimidin-2-yl]methyl]phenyl]ethanol.
| Compound Name | 1-[3-[[4-[5-(2-propan-2-yloxyphenyl)thiophen-2-yl]pyrimidin-2-yl]methyl]phenyl]ethanol |
|---|---|
| PubChem CID | 59607533 |
| Molecular Formula | C26H26N2O2S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 1-[3-[[4-[5-(2-propan-2-yloxyphenyl)thiophen-2-yl]pyrimidin-2-yl]methyl]phenyl]ethanol |
| SMILES | CC(C)Oc1ccccc1-c1ccc(-c2ccnc(Cc3cccc(C(C)O)c3)n2)s1 |
| InChI | InChI=1S/C26H26N2O2S/c1-17(2)30-23-10-5-4-9-21(23)24-11-12-25(31-24)22-13-14-27-26(28-22)16-19-7-6-8-20(15-19)18(3)29/h4-15,17-18,29H,16H2,1-3H3 |
| InChIKey | QJSVUDHOSJSPQV-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |