About (2S)-N-tert-butyl-N,3,3-trimethylbutan-2-amine
(2S)-N-tert-butyl-N,3,3-trimethylbutan-2-amine (PubChem CID 59607895) has the molecular formula C11H25N
and a molecular weight of 171.33 g/mol. Its IUPAC name is (2S)-N-tert-butyl-N,3,3-trimethylbutan-2-amine.
Molecular Properties
| Compound Name | (2S)-N-tert-butyl-N,3,3-trimethylbutan-2-amine |
| PubChem CID | 59607895 |
| Molecular Formula | C11H25N |
| Molecular Weight | 171.33 g/mol |
| Exact Mass | 171.20 |
| IUPAC Name | (2S)-N-tert-butyl-N,3,3-trimethylbutan-2-amine |
| SMILES | C[C@H](N(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H25N/c1-9(10(2,3)4)12(8)11(5,6)7/h9H,1-8H3/t9-/m0/s1 |
| InChIKey | LGAGBQIQIGRMOJ-VIFPVBQESA-N |
| XLogP | 3.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-N-tert-butyl-N,3,3-trimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-tert-butyl-N,3,3-trimethylbutan-2-amine?
The IUPAC name of (2S)-N-tert-butyl-N,3,3-trimethylbutan-2-amine (CID 59607895) is (2S)-N-tert-butyl-N,3,3-trimethylbutan-2-amine.
What is the SMILES notation for (2S)-N-tert-butyl-N,3,3-trimethylbutan-2-amine?
The canonical SMILES for (2S)-N-tert-butyl-N,3,3-trimethylbutan-2-amine is C[C@H](N(C)C(C)(C)C)C(C)(C)C.
What is the InChIKey of (2S)-N-tert-butyl-N,3,3-trimethylbutan-2-amine?
The InChIKey is LGAGBQIQIGRMOJ-VIFPVBQESA-N. The full InChI is InChI=1S/C11H25N/c1-9(10(2,3)4)12(8)11(5,6)7/h9H,1-8H3/t9-/m0/s1.
What are the key properties of (2S)-N-tert-butyl-N,3,3-trimethylbutan-2-amine?
(2S)-N-tert-butyl-N,3,3-trimethylbutan-2-amine has a molecular weight of 171.33 g/mol, XLogP of 3.15, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-tert-butyl-N,3,3-trimethylbutan-2-amine is sourced from PubChem (CID 59607895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).