C12H18O2 — CID 59608045
(3aR,6R,6aS)-6-ethenyl-4-ethyl-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole (PubChem CID 59608045) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (3aR,6R,6aS)-6-ethenyl-4-ethyl-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole.
| Compound Name | (3aR,6R,6aS)-6-ethenyl-4-ethyl-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole |
|---|---|
| PubChem CID | 59608045 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (3aR,6R,6aS)-6-ethenyl-4-ethyl-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxole |
| SMILES | C=C[C@@H]1C=C(CC)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C12H18O2/c1-5-8-7-9(6-2)11-10(8)13-12(3,4)14-11/h5,7-8,10-11H,1,6H2,2-4H3/t8-,10+,11-/m1/s1 |
| InChIKey | VBIBBMWZYJEFHQ-DVVUODLYSA-N |
| XLogP | 2.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|