C23H19Cl2NO4 — CID 59608437
2-[3-[[[2-chloro-5-[(3-chlorophenyl)methoxy]benzoyl]amino]methyl]phenyl]acetic acid (PubChem CID 59608437) has the molecular formula C23H19Cl2NO4 and a molecular weight of 444.31 g/mol. Its IUPAC name is 2-[3-[[[2-chloro-5-[(3-chlorophenyl)methoxy]benzoyl]amino]methyl]phenyl]acetic acid.
| Compound Name | 2-[3-[[[2-chloro-5-[(3-chlorophenyl)methoxy]benzoyl]amino]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 59608437 |
| Molecular Formula | C23H19Cl2NO4 |
| Molecular Weight | 444.31 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | 2-[3-[[[2-chloro-5-[(3-chlorophenyl)methoxy]benzoyl]amino]methyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(CNC(=O)c2cc(OCc3cccc(Cl)c3)ccc2Cl)c1 |
| InChI | InChI=1S/C23H19Cl2NO4/c24-18-6-2-5-17(10-18)14-30-19-7-8-21(25)20(12-19)23(29)26-13-16-4-1-3-15(9-16)11-22(27)28/h1-10,12H,11,13-14H2,(H,26,29)(H,27,28) |
| InChIKey | WUJTWTCLGHWXEJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.31 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |