C40H20F8N2 — CID 59609340
2-[3-[2,5-diphenyl-4-(2,3,4,6-tetrafluoro-5-pyridin-2-ylphenyl)phenyl]-2,4,5,6-tetrafluorophenyl]pyridine (PubChem CID 59609340) has the molecular formula C40H20F8N2 and a molecular weight of 680.60 g/mol. Its IUPAC name is 2-[3-[2,5-diphenyl-4-(2,3,4,6-tetrafluoro-5-pyridin-2-ylphenyl)phenyl]-2,4,5,6-tetrafluorophenyl]pyridine.
| Compound Name | 2-[3-[2,5-diphenyl-4-(2,3,4,6-tetrafluoro-5-pyridin-2-ylphenyl)phenyl]-2,4,5,6-tetrafluorophenyl]pyridine |
|---|---|
| PubChem CID | 59609340 |
| Molecular Formula | C40H20F8N2 |
| Molecular Weight | 680.60 g/mol |
| Exact Mass | 680.15 |
| IUPAC Name | 2-[3-[2,5-diphenyl-4-(2,3,4,6-tetrafluoro-5-pyridin-2-ylphenyl)phenyl]-2,4,5,6-tetrafluorophenyl]pyridine |
| SMILES | Fc1c(F)c(-c2ccccn2)c(F)c(-c2cc(-c3ccccc3)c(-c3c(F)c(F)c(F)c(-c4ccccn4)c3F)cc2-c2ccccc2)c1F |
| InChI | InChI=1S/C40H20F8N2/c41-33-29(35(43)39(47)37(45)31(33)27-15-7-9-17-49-27)25-20-24(22-13-5-2-6-14-22)26(19-23(25)21-11-3-1-4-12-21)30-34(42)32(28-16-8-10-18-50-28)38(46)40(48)36(30)44/h1-20H |
| InChIKey | AECFFXOIOVAHNU-UHFFFAOYSA-N |
| XLogP | 11.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.60 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|