C42H24F8N2 — CID 59609380
3-[3-[2,5-bis(2-methylphenyl)-4-(2,3,4,6-tetrafluoro-5-pyridin-3-ylphenyl)phenyl]-2,4,5,6-tetrafluorophenyl]pyridine (PubChem CID 59609380) has the molecular formula C42H24F8N2 and a molecular weight of 708.65 g/mol. Its IUPAC name is 3-[3-[2,5-bis(2-methylphenyl)-4-(2,3,4,6-tetrafluoro-5-pyridin-3-ylphenyl)phenyl]-2,4,5,6-tetrafluorophenyl]pyridine.
| Compound Name | 3-[3-[2,5-bis(2-methylphenyl)-4-(2,3,4,6-tetrafluoro-5-pyridin-3-ylphenyl)phenyl]-2,4,5,6-tetrafluorophenyl]pyridine |
|---|---|
| PubChem CID | 59609380 |
| Molecular Formula | C42H24F8N2 |
| Molecular Weight | 708.65 g/mol |
| Exact Mass | 708.18 |
| IUPAC Name | 3-[3-[2,5-bis(2-methylphenyl)-4-(2,3,4,6-tetrafluoro-5-pyridin-3-ylphenyl)phenyl]-2,4,5,6-tetrafluorophenyl]pyridine |
| SMILES | Cc1ccccc1-c1cc(-c2c(F)c(F)c(F)c(-c3cccnc3)c2F)c(-c2ccccc2C)cc1-c1c(F)c(F)c(F)c(-c2cccnc2)c1F |
| InChI | InChI=1S/C42H24F8N2/c1-21-9-3-5-13-25(21)27-17-30(34-36(44)32(24-12-8-16-52-20-24)38(46)42(50)40(34)48)28(26-14-6-4-10-22(26)2)18-29(27)33-35(43)31(23-11-7-15-51-19-23)37(45)41(49)39(33)47/h3-20H,1-2H3 |
| InChIKey | YCMAPJUQHMFNFK-UHFFFAOYSA-N |
| XLogP | 12.21 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.65 |
| LogP ≤ 5 | 12.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|