C41H24F3N5 — CID 59609493
9-[5-[2-pyridin-2-yl-6-[10-(trifluoromethyl)phenanthren-2-yl]-4-pyridinyl]-2-pyridinyl]pyrido[2,3-b]indole (PubChem CID 59609493) has the molecular formula C41H24F3N5 and a molecular weight of 643.67 g/mol. Its IUPAC name is 9-[5-[2-pyridin-2-yl-6-[10-(trifluoromethyl)phenanthren-2-yl]-4-pyridinyl]-2-pyridinyl]pyrido[2,3-b]indole.
| Compound Name | 9-[5-[2-pyridin-2-yl-6-[10-(trifluoromethyl)phenanthren-2-yl]-4-pyridinyl]-2-pyridinyl]pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 59609493 |
| Molecular Formula | C41H24F3N5 |
| Molecular Weight | 643.67 g/mol |
| Exact Mass | 643.20 |
| IUPAC Name | 9-[5-[2-pyridin-2-yl-6-[10-(trifluoromethyl)phenanthren-2-yl]-4-pyridinyl]-2-pyridinyl]pyrido[2,3-b]indole |
| SMILES | FC(F)(F)c1cc2ccccc2c2ccc(-c3cc(-c4ccc(-n5c6ccccc6c6cccnc65)nc4)cc(-c4ccccn4)n3)cc12 |
| InChI | InChI=1S/C41H24F3N5/c42-41(43,44)34-21-25-8-1-2-9-29(25)30-16-14-26(20-33(30)34)36-22-28(23-37(48-36)35-12-5-6-18-45-35)27-15-17-39(47-24-27)49-38-13-4-3-10-31(38)32-11-7-19-46-40(32)49/h1-24H |
| InChIKey | CKEQHGGHNXKOSU-UHFFFAOYSA-N |
| XLogP | 10.69 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.67 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|